C33H36INO4 — CID 10282878
trimethyl-[1-oxo-3-phenyl-1-[8-(4-phenylmethoxyphenoxy)octa-3,6-diynoxy]propan-2-yl]azanium iodide (PubChem CID 10282878) has the molecular formula C33H36INO4 and a molecular weight of 637.56 g/mol. Its IUPAC name is trimethyl-[1-oxo-3-phenyl-1-[8-(4-phenylmethoxyphenoxy)octa-3,6-diynoxy]propan-2-yl]azanium iodide.
| Compound Name | trimethyl-[1-oxo-3-phenyl-1-[8-(4-phenylmethoxyphenoxy)octa-3,6-diynoxy]propan-2-yl]azanium iodide |
|---|---|
| PubChem CID | 10282878 |
| Molecular Formula | C33H36INO4 |
| Molecular Weight | 637.56 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | trimethyl-[1-oxo-3-phenyl-1-[8-(4-phenylmethoxyphenoxy)octa-3,6-diynoxy]propan-2-yl]azanium iodide |
| SMILES | C[N+](C)(C)C(Cc1ccccc1)C(=O)OCCC#CCC#CCOc1ccc(OCc2ccccc2)cc1.[I-] |
| InChI | InChI=1S/C33H36NO4.HI/c1-34(2,3)32(26-28-16-10-8-11-17-28)33(35)37-25-15-7-5-4-6-14-24-36-30-20-22-31(23-21-30)38-27-29-18-12-9-13-19-29;/h8-13,16-23,32H,4,15,24-27H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | LNTIKNDPNPGSQZ-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|