C27H37N3O5 — CID 57224597
3-[4-[4-(3,5-dimethylpiperazin-1-yl)butoxy]phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid (PubChem CID 57224597) has the molecular formula C27H37N3O5 and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[4-[4-(3,5-dimethylpiperazin-1-yl)butoxy]phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid.
| Compound Name | 3-[4-[4-(3,5-dimethylpiperazin-1-yl)butoxy]phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid |
|---|---|
| PubChem CID | 57224597 |
| Molecular Formula | C27H37N3O5 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.27 |
| IUPAC Name | 3-[4-[4-(3,5-dimethylpiperazin-1-yl)butoxy]phenyl]-2-[formyl(phenylmethoxy)amino]propanoic acid |
| SMILES | CC1CN(CCCCOc2ccc(CC(C(=O)O)N(C=O)OCc3ccccc3)cc2)CC(C)N1 |
| InChI | InChI=1S/C27H37N3O5/c1-21-17-29(18-22(2)28-21)14-6-7-15-34-25-12-10-23(11-13-25)16-26(27(32)33)30(20-31)35-19-24-8-4-3-5-9-24/h3-5,8-13,20-22,26,28H,6-7,14-19H2,1-2H3,(H,32,33) |
| InChIKey | LCKKPUOKGRFICH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|