C19H28N2O2 — CID 67235001
N-[4-[4-[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]butoxy]phenyl]-N-methylacetamide (PubChem CID 67235001) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is N-[4-[4-[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]butoxy]phenyl]-N-methylacetamide.
| Compound Name | N-[4-[4-[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]butoxy]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 67235001 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | N-[4-[4-[(1R,5S)-3-azabicyclo[3.2.0]heptan-3-yl]butoxy]phenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(OCCCCN2C[C@H]3CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C19H28N2O2/c1-15(22)20(2)18-7-9-19(10-8-18)23-12-4-3-11-21-13-16-5-6-17(16)14-21/h7-10,16-17H,3-6,11-14H2,1-2H3/t16-,17+ |
| InChIKey | LFEMPTBBMSOLJX-CALCHBBNSA-N |
| XLogP | 3.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|