C18H27ClN2O2 — CID 68804530
N-[4-[4-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]butoxy]phenyl]-N-methylacetamide;hydrochloride (PubChem CID 68804530) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is N-[4-[4-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]butoxy]phenyl]-N-methylacetamide;hydrochloride.
| Compound Name | N-[4-[4-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]butoxy]phenyl]-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 68804530 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[4-[4-[(1R,5S)-3-azabicyclo[3.1.0]hexan-3-yl]butoxy]phenyl]-N-methylacetamide;hydrochloride |
| SMILES | CC(=O)N(C)c1ccc(OCCCCN2C[C@H]3C[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-14(21)19(2)17-5-7-18(8-6-17)22-10-4-3-9-20-12-15-11-16(15)13-20;/h5-8,15-16H,3-4,9-13H2,1-2H3;1H/t15-,16+; |
| InChIKey | YELGTMCTEPYQRT-FAESNJTISA-N |
| XLogP | 3.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|