C26H38N2O6 — CID 69065089
4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]-N-cyclopentyl-N-ethylbenzamide;oxalic acid (PubChem CID 69065089) has the molecular formula C26H38N2O6 and a molecular weight of 474.60 g/mol. Its IUPAC name is 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]-N-cyclopentyl-N-ethylbenzamide;oxalic acid.
| Compound Name | 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]-N-cyclopentyl-N-ethylbenzamide;oxalic acid |
|---|---|
| PubChem CID | 69065089 |
| Molecular Formula | C26H38N2O6 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 4-[3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)propoxy]-N-cyclopentyl-N-ethylbenzamide;oxalic acid |
| SMILES | CCN(C(=O)c1ccc(OCCCN2CC3CCCC3C2)cc1)C1CCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H36N2O2.C2H2O4/c1-2-26(22-9-3-4-10-22)24(27)19-11-13-23(14-12-19)28-16-6-15-25-17-20-7-5-8-21(20)18-25;3-1(4)2(5)6/h11-14,20-22H,2-10,15-18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | UIRCDFLJNNDWAG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|