C16H21NO3 — CID 67236243
4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]benzoic acid (PubChem CID 67236243) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]benzoic acid.
| Compound Name | 4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 67236243 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4-[3-[(1R,5R)-6-azabicyclo[3.2.0]heptan-6-yl]propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN2C[C@H]3CCC[C@H]32)cc1 |
| InChI | InChI=1S/C16H21NO3/c18-16(19)12-5-7-14(8-6-12)20-10-2-9-17-11-13-3-1-4-15(13)17/h5-8,13,15H,1-4,9-11H2,(H,18,19)/t13-,15-/m1/s1 |
| InChIKey | OJIPQURGEZPRSM-UKRRQHHQSA-N |
| XLogP | 2.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|