C15H20N2O2 — CID 67234428
4-[3-[(1S,5R)-2-azabicyclo[3.1.0]hexan-2-yl]propoxy]benzamide (PubChem CID 67234428) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-[3-[(1S,5R)-2-azabicyclo[3.1.0]hexan-2-yl]propoxy]benzamide.
| Compound Name | 4-[3-[(1S,5R)-2-azabicyclo[3.1.0]hexan-2-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 67234428 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 4-[3-[(1S,5R)-2-azabicyclo[3.1.0]hexan-2-yl]propoxy]benzamide |
| SMILES | NC(=O)c1ccc(OCCCN2CC[C@@H]3C[C@@H]32)cc1 |
| InChI | InChI=1S/C15H20N2O2/c16-15(18)11-2-4-13(5-3-11)19-9-1-7-17-8-6-12-10-14(12)17/h2-5,12,14H,1,6-10H2,(H2,16,18)/t12-,14+/m1/s1 |
| InChIKey | ZTWAPARMYKEFFT-OCCSQVGLSA-N |
| XLogP | 1.65 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|