C19H25N3O3 — CID 91839674
4-[3-[2-(5-methyl-1,2-oxazol-3-yl)piperidin-1-yl]propoxy]benzamide (PubChem CID 91839674) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 4-[3-[2-(5-methyl-1,2-oxazol-3-yl)piperidin-1-yl]propoxy]benzamide.
| Compound Name | 4-[3-[2-(5-methyl-1,2-oxazol-3-yl)piperidin-1-yl]propoxy]benzamide |
|---|---|
| PubChem CID | 91839674 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-[3-[2-(5-methyl-1,2-oxazol-3-yl)piperidin-1-yl]propoxy]benzamide |
| SMILES | Cc1cc(C2CCCCN2CCCOc2ccc(C(N)=O)cc2)no1 |
| InChI | InChI=1S/C19H25N3O3/c1-14-13-17(21-25-14)18-5-2-3-10-22(18)11-4-12-24-16-8-6-15(7-9-16)19(20)23/h6-9,13,18H,2-5,10-12H2,1H3,(H2,20,23) |
| InChIKey | XBCVLCRHQWWUBQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|