C15H18ClNO2 — CID 89123797
4-[3-(2-azabicyclo[3.1.0]hexan-2-yl)propoxy]benzoyl chloride (PubChem CID 89123797) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-[3-(2-azabicyclo[3.1.0]hexan-2-yl)propoxy]benzoyl chloride.
| Compound Name | 4-[3-(2-azabicyclo[3.1.0]hexan-2-yl)propoxy]benzoyl chloride |
|---|---|
| PubChem CID | 89123797 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 4-[3-(2-azabicyclo[3.1.0]hexan-2-yl)propoxy]benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(OCCCN2CCC3CC32)cc1 |
| InChI | InChI=1S/C15H18ClNO2/c16-15(18)11-2-4-13(5-3-11)19-9-1-7-17-8-6-12-10-14(12)17/h2-5,12,14H,1,6-10H2 |
| InChIKey | YNWTXDVXQONCAQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|