C30H45ClN2O5 — CID 161045120
methane;4-(2-piperidin-1-ylethoxy)benzoic acid;4-(2-piperidin-1-ylethoxy)benzoyl chloride (PubChem CID 161045120) has the molecular formula C30H45ClN2O5 and a molecular weight of 549.15 g/mol. Its IUPAC name is methane;4-(2-piperidin-1-ylethoxy)benzoic acid;4-(2-piperidin-1-ylethoxy)benzoyl chloride.
| Compound Name | methane;4-(2-piperidin-1-ylethoxy)benzoic acid;4-(2-piperidin-1-ylethoxy)benzoyl chloride |
|---|---|
| PubChem CID | 161045120 |
| Molecular Formula | C30H45ClN2O5 |
| Molecular Weight | 549.15 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | methane;4-(2-piperidin-1-ylethoxy)benzoic acid;4-(2-piperidin-1-ylethoxy)benzoyl chloride |
| SMILES | C.C.O=C(Cl)c1ccc(OCCN2CCCCC2)cc1.O=C(O)c1ccc(OCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C14H18ClNO2.C14H19NO3.2CH4/c15-14(17)12-4-6-13(7-5-12)18-11-10-16-8-2-1-3-9-16;16-14(17)12-4-6-13(7-5-12)18-11-10-15-8-2-1-3-9-15;;/h4-7H,1-3,8-11H2;4-7H,1-3,8-11H2,(H,16,17);2*1H4 |
| InChIKey | UBKCZZKPMQXAGK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.15 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|