C24H28N2O6 — CID 140590606
prop-2-enyl (2S)-5-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 140590606) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is prop-2-enyl (2S)-5-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | prop-2-enyl (2S)-5-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 140590606 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | prop-2-enyl (2S)-5-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | C=CCOC(=O)[C@H](CCCN(C)C(=O)c1cccc(O)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O6/c1-3-15-31-23(29)21(25-24(30)32-17-18-9-5-4-6-10-18)13-8-14-26(2)22(28)19-11-7-12-20(27)16-19/h3-7,9-12,16,21,27H,1,8,13-15,17H2,2H3,(H,25,30)/t21-/m0/s1 |
| InChIKey | LXHWMXDZGQMSIQ-NRFANRHFSA-N |
| XLogP | 3.27 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|