C22H24N2O6 — CID 140590608
prop-2-enyl (2S)-3-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 140590608) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | prop-2-enyl (2S)-3-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 140590608 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | prop-2-enyl (2S)-3-[(3-hydroxybenzoyl)-methylamino]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)[C@H](CN(C)C(=O)c1cccc(O)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O6/c1-3-12-29-21(27)19(23-22(28)30-15-16-8-5-4-6-9-16)14-24(2)20(26)17-10-7-11-18(25)13-17/h3-11,13,19,25H,1,12,14-15H2,2H3,(H,23,28)/t19-/m0/s1 |
| InChIKey | DHUOULFBIZUOOF-IBGZPJMESA-N |
| XLogP | 2.49 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|