C42H50N4O9 — CID 136998562
[5-[2-[[(2S)-1-(4-acetylphenyl)-3-oxobutan-2-yl]amino]-2-oxoethyl]-5,6,7,8-tetrahydronaphthalen-2-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate (PubChem CID 136998562) has the molecular formula C42H50N4O9 and a molecular weight of 754.88 g/mol. Its IUPAC name is [5-[2-[[(2S)-1-(4-acetylphenyl)-3-oxobutan-2-yl]amino]-2-oxoethyl]-5,6,7,8-tetrahydronaphthalen-2-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate.
| Compound Name | [5-[2-[[(2S)-1-(4-acetylphenyl)-3-oxobutan-2-yl]amino]-2-oxoethyl]-5,6,7,8-tetrahydronaphthalen-2-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
|---|---|
| PubChem CID | 136998562 |
| Molecular Formula | C42H50N4O9 |
| Molecular Weight | 754.88 g/mol |
| Exact Mass | 754.36 |
| IUPAC Name | [5-[2-[[(2S)-1-(4-acetylphenyl)-3-oxobutan-2-yl]amino]-2-oxoethyl]-5,6,7,8-tetrahydronaphthalen-2-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
| SMILES | CC(=O)c1ccc(C[C@H](NC(=O)CC2CCCc3cc(OC(=O)c4ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc4)ccc32)C(C)=O)cc1 |
| InChI | InChI=1S/C42H50N4O9/c1-25(47)28-14-12-27(13-15-28)22-35(26(2)48)44-36(49)24-31-11-9-10-30-23-33(20-21-34(30)31)53-37(50)29-16-18-32(19-17-29)43-38(45-39(51)54-41(3,4)5)46-40(52)55-42(6,7)8/h12-21,23,31,35H,9-11,22,24H2,1-8H3,(H,44,49)(H2,43,45,46,51,52)/t31?,35-/m0/s1 |
| InChIKey | HSVQPRNEDFYFOQ-IKAUJVHPSA-N |
| XLogP | 7.27 |
| TPSA | 178.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.88 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|