C38H51N7O11 — CID 164941110
ditert-butyl 2-[[2-[8-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl]acetyl]amino]butanedioate (PubChem CID 164941110) has the molecular formula C38H51N7O11 and a molecular weight of 781.86 g/mol. Its IUPAC name is ditert-butyl 2-[[2-[8-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl]acetyl]amino]butanedioate.
| Compound Name | ditert-butyl 2-[[2-[8-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl]acetyl]amino]butanedioate |
|---|---|
| PubChem CID | 164941110 |
| Molecular Formula | C38H51N7O11 |
| Molecular Weight | 781.86 g/mol |
| Exact Mass | 781.36 |
| IUPAC Name | ditert-butyl 2-[[2-[8-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-[1,2,4]triazolo[1,5-a]pyridin-5-yl]acetyl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)Cc1ccc(OC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)c2ncnn12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H51N7O11/c1-35(2,3)53-28(47)20-25(31(49)54-36(4,5)6)42-27(46)19-24-17-18-26(29-39-21-40-45(24)29)52-30(48)22-13-15-23(16-14-22)41-32(43-33(50)55-37(7,8)9)44-34(51)56-38(10,11)12/h13-18,21,25H,19-20H2,1-12H3,(H,42,46)(H2,41,43,44,50,51) |
| InChIKey | FWOAYESMVLQQIM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 227.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.86 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|