C21H23N5O4 — CID 155587165
[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-(1-aminoethylideneamino)benzoate (PubChem CID 155587165) has the molecular formula C21H23N5O4 and a molecular weight of 409.45 g/mol. Its IUPAC name is [5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-(1-aminoethylideneamino)benzoate.
| Compound Name | [5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-(1-aminoethylideneamino)benzoate |
|---|---|
| PubChem CID | 155587165 |
| Molecular Formula | C21H23N5O4 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | [5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-(1-aminoethylideneamino)benzoate |
| SMILES | C/C(N)=N\c1ccc(C(=O)Oc2ccc(CC(=O)OC(C)(C)C)n3ncnc23)cc1 |
| InChI | InChI=1S/C21H23N5O4/c1-13(22)25-15-7-5-14(6-8-15)20(28)29-17-10-9-16(26-19(17)23-12-24-26)11-18(27)30-21(2,3)4/h5-10,12H,11H2,1-4H3,(H2,22,25) |
| InChIKey | RPAQFSDCAVVFQS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 121.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|