C30H37IN6O8 — CID 155587044
[5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-iodobenzoate (PubChem CID 155587044) has the molecular formula C30H37IN6O8 and a molecular weight of 736.56 g/mol. Its IUPAC name is [5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-iodobenzoate.
| Compound Name | [5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-iodobenzoate |
|---|---|
| PubChem CID | 155587044 |
| Molecular Formula | C30H37IN6O8 |
| Molecular Weight | 736.56 g/mol |
| Exact Mass | 736.17 |
| IUPAC Name | [5-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-[1,2,4]triazolo[1,5-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-iodobenzoate |
| SMILES | CC(C)(C)OC(=O)Cc1ccc(OC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2I)c2ncnn12 |
| InChI | InChI=1S/C30H37IN6O8/c1-28(2,3)43-22(38)15-18-11-13-21(23-32-16-33-37(18)23)42-24(39)19-12-10-17(14-20(19)31)34-25(35-26(40)44-29(4,5)6)36-27(41)45-30(7,8)9/h10-14,16H,15H2,1-9H3,(H2,34,35,36,40,41) |
| InChIKey | KJSFAXQRNQOZHL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 171.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|