C20H22N2O3 — CID 155587102
tert-butyl 2-(8-phenylmethoxyimidazo[1,2-a]pyridin-5-yl)acetate (PubChem CID 155587102) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is tert-butyl 2-(8-phenylmethoxyimidazo[1,2-a]pyridin-5-yl)acetate.
| Compound Name | tert-butyl 2-(8-phenylmethoxyimidazo[1,2-a]pyridin-5-yl)acetate |
|---|---|
| PubChem CID | 155587102 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | tert-butyl 2-(8-phenylmethoxyimidazo[1,2-a]pyridin-5-yl)acetate |
| SMILES | CC(C)(C)OC(=O)Cc1ccc(OCc2ccccc2)c2nccn12 |
| InChI | InChI=1S/C20H22N2O3/c1-20(2,3)25-18(23)13-16-9-10-17(19-21-11-12-22(16)19)24-14-15-7-5-4-6-8-15/h4-12H,13-14H2,1-3H3 |
| InChIKey | NPDWQSRZKGMRRT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |