C27H30N2O5 — CID 23511829
tert-butyl 2-[3-methoxy-4-[(2-phenylmethoxyphenyl)carbamoylamino]phenyl]acetate (PubChem CID 23511829) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is tert-butyl 2-[3-methoxy-4-[(2-phenylmethoxyphenyl)carbamoylamino]phenyl]acetate.
| Compound Name | tert-butyl 2-[3-methoxy-4-[(2-phenylmethoxyphenyl)carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 23511829 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | tert-butyl 2-[3-methoxy-4-[(2-phenylmethoxyphenyl)carbamoylamino]phenyl]acetate |
| SMILES | COc1cc(CC(=O)OC(C)(C)C)ccc1NC(=O)Nc1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H30N2O5/c1-27(2,3)34-25(30)17-20-14-15-22(24(16-20)32-4)29-26(31)28-21-12-8-9-13-23(21)33-18-19-10-6-5-7-11-19/h5-16H,17-18H2,1-4H3,(H2,28,29,31) |
| InChIKey | FHOVJBMHSJFVOE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |