C17H25N3O6S — CID 164941114
methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]thiophene-2-carboxylate (PubChem CID 164941114) has the molecular formula C17H25N3O6S and a molecular weight of 399.47 g/mol. Its IUPAC name is methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]thiophene-2-carboxylate.
| Compound Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 164941114 |
| Molecular Formula | C17H25N3O6S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C17H25N3O6S/c1-16(2,3)25-14(22)19-13(20-15(23)26-17(4,5)6)18-11-9-8-10(27-11)12(21)24-7/h8-9H,1-7H3,(H2,18,19,20,22,23) |
| InChIKey | RSQHYKHZWJUIAT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|