C19H28N4O7S — CID 23398266
5-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethylcarbamoyl]thiophene-2-carboxylic acid (PubChem CID 23398266) has the molecular formula C19H28N4O7S and a molecular weight of 456.52 g/mol. Its IUPAC name is 5-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethylcarbamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethylcarbamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 23398266 |
| Molecular Formula | C19H28N4O7S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 5-[2-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]ethylcarbamoyl]thiophene-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NC(=NCCNC(=O)c1ccc(C(=O)O)s1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H28N4O7S/c1-18(2,3)29-16(27)22-15(23-17(28)30-19(4,5)6)21-10-9-20-13(24)11-7-8-12(31-11)14(25)26/h7-8H,9-10H2,1-6H3,(H,20,24)(H,25,26)(H2,21,22,23,27,28) |
| InChIKey | TXVFJGFVYDKPAE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 155.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|