C14H21N3O3S — CID 170490426
tert-butyl N-[4-[5-(hydrazinecarbonyl)thiophen-2-yl]but-3-enyl]carbamate (PubChem CID 170490426) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is tert-butyl N-[4-[5-(hydrazinecarbonyl)thiophen-2-yl]but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-(hydrazinecarbonyl)thiophen-2-yl]but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170490426 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | tert-butyl N-[4-[5-(hydrazinecarbonyl)thiophen-2-yl]but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccc(C(=O)NN)s1 |
| InChI | InChI=1S/C14H21N3O3S/c1-14(2,3)20-13(19)16-9-5-4-6-10-7-8-11(21-10)12(18)17-15/h4,6-8H,5,9,15H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | ASUDSKFFNOQPGZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|