C21H30N4O8 — CID 135467878
methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-(2-nitroethyl)benzoate (PubChem CID 135467878) has the molecular formula C21H30N4O8 and a molecular weight of 466.49 g/mol. Its IUPAC name is methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-(2-nitroethyl)benzoate.
| Compound Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-(2-nitroethyl)benzoate |
|---|---|
| PubChem CID | 135467878 |
| Molecular Formula | C21H30N4O8 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-5-(2-nitroethyl)benzoate |
| SMILES | COC(=O)c1cc(CC[N+](=O)[O-])cc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H30N4O8/c1-20(2,3)32-18(27)23-17(24-19(28)33-21(4,5)6)22-15-11-13(8-9-25(29)30)10-14(12-15)16(26)31-7/h10-12H,8-9H2,1-7H3,(H2,22,23,24,27,28) |
| InChIKey | LODXOLOYGRFKLS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|