C26H38N4O8 — CID 138958229
dimethyl 5-[[4-[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperazin-1-yl]methyl]benzene-1,3-dicarboxylate (PubChem CID 138958229) has the molecular formula C26H38N4O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is dimethyl 5-[[4-[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperazin-1-yl]methyl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperazin-1-yl]methyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 138958229 |
| Molecular Formula | C26H38N4O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | dimethyl 5-[[4-[(E)-N,N'-bis[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]piperazin-1-yl]methyl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(CN2CCN(/C(=N/C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)CC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C26H38N4O8/c1-25(2,3)37-23(33)27-22(28-24(34)38-26(4,5)6)30-11-9-29(10-12-30)16-17-13-18(20(31)35-7)15-19(14-17)21(32)36-8/h13-15H,9-12,16H2,1-8H3,(H,27,28,33,34) |
| InChIKey | MUDMRDNXNSYMOE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|