C22H35N5O4 — CID 174023782
tert-butyl N-[[4-(4-amino-3-methylphenyl)piperazin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 174023782) has the molecular formula C22H35N5O4 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl N-[[4-(4-amino-3-methylphenyl)piperazin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl N-[[4-(4-amino-3-methylphenyl)piperazin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 174023782 |
| Molecular Formula | C22H35N5O4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | tert-butyl N-[[4-(4-amino-3-methylphenyl)piperazin-1-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | Cc1cc(N2CCN(C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)CC2)ccc1N |
| InChI | InChI=1S/C22H35N5O4/c1-15-14-16(8-9-17(15)23)26-10-12-27(13-11-26)18(24-19(28)30-21(2,3)4)25-20(29)31-22(5,6)7/h8-9,14H,10-13,23H2,1-7H3,(H,24,25,28,29) |
| InChIKey | PQWUZCCBMZUDQJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|