C20H28BrN3O4 — CID 121464123
tert-butyl (NE)-N-[(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 121464123) has the molecular formula C20H28BrN3O4 and a molecular weight of 454.37 g/mol. Its IUPAC name is tert-butyl (NE)-N-[(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 121464123 |
| Molecular Formula | C20H28BrN3O4 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | tert-butyl (NE)-N-[(7-bromo-3,4-dihydro-1H-isoquinolin-2-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(\NC(=O)OC(C)(C)C)N1CCc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C20H28BrN3O4/c1-19(2,3)27-17(25)22-16(23-18(26)28-20(4,5)6)24-10-9-13-7-8-15(21)11-14(13)12-24/h7-8,11H,9-10,12H2,1-6H3,(H,22,23,25,26) |
| InChIKey | TTXFZCSGCHUQBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|