C22H35N5O5 — CID 20825963
tert-butyl (NZ)-N-[[2-(2-methoxyethylamino)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 20825963) has the molecular formula C22H35N5O5 and a molecular weight of 449.55 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[[2-(2-methoxyethylamino)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[[2-(2-methoxyethylamino)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 20825963 |
| Molecular Formula | C22H35N5O5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | tert-butyl (NZ)-N-[[2-(2-methoxyethylamino)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | COCCNc1ccc2c(n1)CCN(/C(=N\C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C22H35N5O5/c1-21(2,3)31-19(28)25-18(26-20(29)32-22(4,5)6)27-12-10-16-15(14-27)8-9-17(24-16)23-11-13-30-7/h8-9H,10-14H2,1-7H3,(H,23,24)(H,25,26,28,29) |
| InChIKey | MIWNTPPNRPNLDM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|