C30H36N4O8 — CID 158669449
tert-butyl N-[[7-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 158669449) has the molecular formula C30H36N4O8 and a molecular weight of 580.64 g/mol. Its IUPAC name is tert-butyl N-[[7-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl N-[[7-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 158669449 |
| Molecular Formula | C30H36N4O8 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | tert-butyl N-[[7-[2-(1,3-dioxoisoindol-2-yl)oxyethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=C(NC(=O)OC(C)(C)C)N1CCc2ccc(OCCON3C(=O)c4ccccc4C3=O)cc2C1 |
| InChI | InChI=1S/C30H36N4O8/c1-29(2,3)41-27(37)31-26(32-28(38)42-30(4,5)6)33-14-13-19-11-12-21(17-20(19)18-33)39-15-16-40-34-24(35)22-9-7-8-10-23(22)25(34)36/h7-12,17H,13-16,18H2,1-6H3,(H,31,32,37,38) |
| InChIKey | HOOYICJREMNUJR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|