C31H42N6O7 — CID 18536535
tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]methylidene]carbamate (PubChem CID 18536535) has the molecular formula C31H42N6O7 and a molecular weight of 610.71 g/mol. Its IUPAC name is tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]methylidene]carbamate.
| Compound Name | tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 18536535 |
| Molecular Formula | C31H42N6O7 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | tert-butyl (NZ)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinolin-2-yl]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(/NC(=O)OC(C)(C)C)N1CCc2ccc(OCC3CCN(c4ccc([N+](=O)[O-])cn4)CC3)cc2C1 |
| InChI | InChI=1S/C31H42N6O7/c1-30(2,3)43-28(38)33-27(34-29(39)44-31(4,5)6)36-16-13-22-7-9-25(17-23(22)19-36)42-20-21-11-14-35(15-12-21)26-10-8-24(18-32-26)37(40)41/h7-10,17-18,21H,11-16,19-20H2,1-6H3,(H,33,34,38,39) |
| InChIKey | USXZIVDVLMUKPQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 148.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|