C22H26N6O5 — CID 139830932
[7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid (PubChem CID 139830932) has the molecular formula C22H26N6O5 and a molecular weight of 454.49 g/mol. Its IUPAC name is [7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid.
| Compound Name | [7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid |
|---|---|
| PubChem CID | 139830932 |
| Molecular Formula | C22H26N6O5 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | [7-[[1-(5-nitro-2-pyridinyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinoline-1-carboximidoyl]carbamic acid |
| SMILES | [H]/N=C(\NC(=O)O)C1NCCc2ccc(OCC3CCN(c4ccc([N+](=O)[O-])cn4)CC3)cc21 |
| InChI | InChI=1S/C22H26N6O5/c23-21(26-22(29)30)20-18-11-17(3-1-15(18)5-8-24-20)33-13-14-6-9-27(10-7-14)19-4-2-16(12-25-19)28(31)32/h1-4,11-12,14,20,24H,5-10,13H2,(H2,23,26)(H,29,30) |
| InChIKey | UUNNDZJUNNGSED-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|