C23H29N5O3 — CID 139830960
[amino-[7-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid (PubChem CID 139830960) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is [amino-[7-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid.
| Compound Name | [amino-[7-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid |
|---|---|
| PubChem CID | 139830960 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | [amino-[7-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methoxy]-1,2,3,4-tetrahydroisoquinolin-1-yl]methylidene]carbamic acid |
| SMILES | NC(=NC(=O)O)C1NCCc2ccc(OCC3CCN(Cc4ccccn4)CC3)cc21 |
| InChI | InChI=1S/C23H29N5O3/c24-22(27-23(29)30)21-20-13-19(5-4-17(20)6-10-26-21)31-15-16-7-11-28(12-8-16)14-18-3-1-2-9-25-18/h1-5,9,13,16,21,26H,6-8,10-12,14-15H2,(H2,24,27)(H,29,30) |
| InChIKey | DYSUWVOMTLGGHT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|