C28H32N4O6 — CID 59647428
tert-butyl (NE)-N-[(2,3-dioxo-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-8-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate (PubChem CID 59647428) has the molecular formula C28H32N4O6 and a molecular weight of 520.59 g/mol. Its IUPAC name is tert-butyl (NE)-N-[(2,3-dioxo-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-8-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[(2,3-dioxo-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-8-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 59647428 |
| Molecular Formula | C28H32N4O6 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | tert-butyl (NE)-N-[(2,3-dioxo-5-phenyl-1,6,7,9-tetrahydropyrrolo[3,2-h]isoquinolin-8-yl)-[(2-methylpropan-2-yl)oxycarbonylamino]methylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)/N=C(\NC(=O)OC(C)(C)C)N1CCc2c(-c3ccccc3)cc3c(c2C1)NC(=O)C3=O |
| InChI | InChI=1S/C28H32N4O6/c1-27(2,3)37-25(35)30-24(31-26(36)38-28(4,5)6)32-13-12-17-18(16-10-8-7-9-11-16)14-19-21(20(17)15-32)29-23(34)22(19)33/h7-11,14H,12-13,15H2,1-6H3,(H,29,33,34)(H,30,31,35,36) |
| InChIKey | NYLJXMWLUNAXJX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|