C12H18N3O- — CID 20825839
6-methanidyl-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-amine (PubChem CID 20825839) has the molecular formula C12H18N3O- and a molecular weight of 220.30 g/mol. Its IUPAC name is 6-methanidyl-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-amine.
| Compound Name | 6-methanidyl-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 20825839 |
| Molecular Formula | C12H18N3O- |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 6-methanidyl-N-(2-methoxyethyl)-7,8-dihydro-5H-1,6-naphthyridin-2-amine |
| SMILES | [CH2-]N1CCc2nc(NCCOC)ccc2C1 |
| InChI | InChI=1S/C12H18N3O/c1-15-7-5-11-10(9-15)3-4-12(14-11)13-6-8-16-2/h3-4H,1,5-9H2,2H3,(H,13,14)/q-1 |
| InChIKey | ZVSOERROJCGMEV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|