C13H21N4- — CID 20825913
N-(6-methanidyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 20825913) has the molecular formula C13H21N4- and a molecular weight of 233.34 g/mol. Its IUPAC name is N-(6-methanidyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(6-methanidyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 20825913 |
| Molecular Formula | C13H21N4- |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-(6-methanidyl-7,8-dihydro-5H-1,6-naphthyridin-2-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | [CH2-]N1CCc2nc(NCCN(C)C)ccc2C1 |
| InChI | InChI=1S/C13H21N4/c1-16(2)9-7-14-13-5-4-11-10-17(3)8-6-12(11)15-13/h4-5H,3,6-10H2,1-2H3,(H,14,15)/q-1 |
| InChIKey | BFARQOWQQQKDKV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|