C12H18N8O — CID 175549085
2-N-(2-methoxyethyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 175549085) has the molecular formula C12H18N8O and a molecular weight of 290.33 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 175549085 |
| Molecular Formula | C12H18N8O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-N-(2-methoxyethyl)-6-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | COCCNc1nc(N)nc(N2CCc3nc[nH]c3C2)n1 |
| InChI | InChI=1S/C12H18N8O/c1-21-5-3-14-11-17-10(13)18-12(19-11)20-4-2-8-9(6-20)16-7-15-8/h7H,2-6H2,1H3,(H,15,16)(H3,13,14,17,18,19) |
| InChIKey | RCRFIDFNGZSJFO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|