C34H42BN5O4S — CID 173480945
CID 173480945 (PubChem CID 173480945) has the molecular formula C34H42BN5O4S and a molecular weight of 627.62 g/mol.
| Compound Name | CID 173480945 |
|---|---|
| PubChem CID | 173480945 |
| Molecular Formula | C34H42BN5O4S |
| Molecular Weight | 627.62 g/mol |
| Exact Mass | 627.31 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(Sc2ncccc2CN2CCN(C(=NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H42BN5O4S/c1-33(2,3)43-31(41)37-30(38-32(42)44-34(4,5)6)40-21-19-39(20-22-40)23-26-13-10-18-36-29(26)45-28(24-11-8-7-9-12-24)25-14-16-27(35)17-15-25/h7-18,28H,19-23H2,1-6H3,(H,37,38,41,42) |
| InChIKey | XKXVCWCUYGOULN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|