C18H26N4O7 — CID 136945281
tert-butyl N-[N'-(3-methoxy-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 136945281) has the molecular formula C18H26N4O7 and a molecular weight of 410.43 g/mol. Its IUPAC name is tert-butyl N-[N'-(3-methoxy-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-(3-methoxy-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 136945281 |
| Molecular Formula | C18H26N4O7 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | tert-butyl N-[N'-(3-methoxy-5-nitrophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | COc1cc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N4O7/c1-17(2,3)28-15(23)20-14(21-16(24)29-18(4,5)6)19-11-8-12(22(25)26)10-13(9-11)27-7/h8-10H,1-7H3,(H2,19,20,21,23,24) |
| InChIKey | CVOPYMZRIVYFBM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|