C38H50N4O12 — CID 137245203
ditert-butyl 2-[[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-11-oxo-6H-benzo[c][1,6]benzodioxocine-4-carbonyl]amino]butanedioate (PubChem CID 137245203) has the molecular formula C38H50N4O12 and a molecular weight of 754.83 g/mol. Its IUPAC name is ditert-butyl 2-[[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-11-oxo-6H-benzo[c][1,6]benzodioxocine-4-carbonyl]amino]butanedioate.
| Compound Name | ditert-butyl 2-[[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-11-oxo-6H-benzo[c][1,6]benzodioxocine-4-carbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 137245203 |
| Molecular Formula | C38H50N4O12 |
| Molecular Weight | 754.83 g/mol |
| Exact Mass | 754.34 |
| IUPAC Name | ditert-butyl 2-[[8-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-11-oxo-6H-benzo[c][1,6]benzodioxocine-4-carbonyl]amino]butanedioate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)c1cccc2c1OCc1cc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)ccc1C(=O)O2)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H50N4O12/c1-35(2,3)51-27(43)19-25(31(46)52-36(4,5)6)40-29(44)24-14-13-15-26-28(24)49-20-21-18-22(16-17-23(21)30(45)50-26)39-32(41-33(47)53-37(7,8)9)42-34(48)54-38(10,11)12/h13-18,25H,19-20H2,1-12H3,(H,40,44)(H2,39,41,42,47,48) |
| InChIKey | ZWBZUMZBGPQMSD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 206.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|