C18H19NO5 — CID 89150272
[2-amino-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate (PubChem CID 89150272) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is [2-amino-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate.
| Compound Name | [2-amino-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 89150272 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [2-amino-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate |
| SMILES | COc1cc(C(=O)OC(C(N)=O)[C@]2(C)CO2)c2cccc(C)c2c1 |
| InChI | InChI=1S/C18H19NO5/c1-10-5-4-6-12-13(10)7-11(22-3)8-14(12)17(21)24-15(16(19)20)18(2)9-23-18/h4-8,15H,9H2,1-3H3,(H2,19,20)/t15?,18-/m0/s1 |
| InChIKey | KDYGKLQSWCCUFT-PKHIMPSTSA-N |
| XLogP | 1.96 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|