About 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid
4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid (PubChem CID 159879182) has the molecular formula C16H13Cl2IO4
and a molecular weight of 467.09 g/mol. Its IUPAC name is 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid |
| PubChem CID | 159879182 |
| Molecular Formula | C16H13Cl2IO4 |
| Molecular Weight | 467.09 g/mol |
| Exact Mass | 465.92 |
| IUPAC Name | 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid |
| SMILES | Cc1cc(Cl)c(I)cc1C(=O)O.Cc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C8H6ClIO2.C8H7ClO2/c1-4-2-6(9)7(10)3-5(4)8(11)12;1-5-4-6(9)2-3-7(5)8(10)11/h2-3H,1H3,(H,11,12);2-4H,1H3,(H,10,11) |
| InChIKey | NTHQMEDXVRIMBU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.09 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid?
The IUPAC name of 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid (CID 159879182) is 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid.
What is the SMILES notation for 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid?
The canonical SMILES for 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid is Cc1cc(Cl)c(I)cc1C(=O)O.Cc1cc(Cl)ccc1C(=O)O.
What is the InChIKey of 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid?
The InChIKey is NTHQMEDXVRIMBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClIO2.C8H7ClO2/c1-4-2-6(9)7(10)3-5(4)8(11)12;1-5-4-6(9)2-3-7(5)8(10)11/h2-3H,1H3,(H,11,12);2-4H,1H3,(H,10,11).
What are the key properties of 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid?
4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid has a molecular weight of 467.09 g/mol, XLogP of 5.30, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-iodo-2-methylbenzoic acid;4-chloro-2-methylbenzoic acid is sourced from PubChem (CID 159879182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).