C22H15NO4S — CID 19808788
5-methyl-2-(4-methylphenyl)-6,6-dioxo-[1]benzothiolo[3,2-e]isoindole-1,3-dione (PubChem CID 19808788) has the molecular formula C22H15NO4S and a molecular weight of 389.43 g/mol. Its IUPAC name is 5-methyl-2-(4-methylphenyl)-6,6-dioxo-[1]benzothiolo[3,2-e]isoindole-1,3-dione.
| Compound Name | 5-methyl-2-(4-methylphenyl)-6,6-dioxo-[1]benzothiolo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19808788 |
| Molecular Formula | C22H15NO4S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 5-methyl-2-(4-methylphenyl)-6,6-dioxo-[1]benzothiolo[3,2-e]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)c3cc(C)c4c(c3C2=O)-c2ccccc2S4(=O)=O)cc1 |
| InChI | InChI=1S/C22H15NO4S/c1-12-7-9-14(10-8-12)23-21(24)16-11-13(2)20-18(19(16)22(23)25)15-5-3-4-6-17(15)28(20,26)27/h3-11H,1-2H3 |
| InChIKey | OKBVRPBVYARRGK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|