C18H14O2S — CID 59403831
5,9-dimethylnaphtho[2,1-b][1]benzothiole 7,7-dioxide (PubChem CID 59403831) has the molecular formula C18H14O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7,7-dioxide.
| Compound Name | 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7,7-dioxide |
|---|---|
| PubChem CID | 59403831 |
| Molecular Formula | C18H14O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 5,9-dimethylnaphtho[2,1-b][1]benzothiole 7,7-dioxide |
| SMILES | Cc1ccc2c(c1)S(=O)(=O)c1cc(C)c3ccccc3c1-2 |
| InChI | InChI=1S/C18H14O2S/c1-11-7-8-15-16(9-11)21(19,20)17-10-12(2)13-5-3-4-6-14(13)18(15)17/h3-10H,1-2H3 |
| InChIKey | WISCVMWDVATIEI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |