C28H15N5O2S — CID 168735922
2-[(2-phenyl-4-pyrimidin-5-ylimidazo[4,5-d][1,3]thiazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735922) has the molecular formula C28H15N5O2S and a molecular weight of 485.53 g/mol. Its IUPAC name is 2-[(2-phenyl-4-pyrimidin-5-ylimidazo[4,5-d][1,3]thiazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[(2-phenyl-4-pyrimidin-5-ylimidazo[4,5-d][1,3]thiazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735922 |
| Molecular Formula | C28H15N5O2S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | 2-[(2-phenyl-4-pyrimidin-5-ylimidazo[4,5-d][1,3]thiazol-5-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4ccccc4)nc3n2-c2cncnc2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C28H15N5O2S/c34-24-20-10-17-8-4-5-9-18(17)11-21(20)25(35)22(24)12-23-31-28-26(33(23)19-13-29-15-30-14-19)32-27(36-28)16-6-2-1-3-7-16/h1-15H |
| InChIKey | VHHXXZMBBXRPNR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|