C32H17N3O2S2 — CID 168735600
2-[[2-(1-benzothiophen-2-yl)-4-phenylimidazo[4,5-d][1,3]thiazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735600) has the molecular formula C32H17N3O2S2 and a molecular weight of 539.64 g/mol. Its IUPAC name is 2-[[2-(1-benzothiophen-2-yl)-4-phenylimidazo[4,5-d][1,3]thiazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[2-(1-benzothiophen-2-yl)-4-phenylimidazo[4,5-d][1,3]thiazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735600 |
| Molecular Formula | C32H17N3O2S2 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | 2-[[2-(1-benzothiophen-2-yl)-4-phenylimidazo[4,5-d][1,3]thiazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4cc5ccccc5s4)nc3n2-c2ccccc2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C32H17N3O2S2/c36-28-22-14-18-8-4-5-9-19(18)15-23(22)29(37)24(28)17-27-33-32-30(35(27)21-11-2-1-3-12-21)34-31(39-32)26-16-20-10-6-7-13-25(20)38-26/h1-17H |
| InChIKey | JYJOHTMJPVRFCA-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|