C34H26N2O2SSi — CID 168736033
2-[[5-phenyl-1-(4-trimethylsilylphenyl)thieno[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168736033) has the molecular formula C34H26N2O2SSi and a molecular weight of 554.75 g/mol. Its IUPAC name is 2-[[5-phenyl-1-(4-trimethylsilylphenyl)thieno[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[5-phenyl-1-(4-trimethylsilylphenyl)thieno[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168736033 |
| Molecular Formula | C34H26N2O2SSi |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 2-[[5-phenyl-1-(4-trimethylsilylphenyl)thieno[2,3-d]imidazol-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | C[Si](C)(C)c1ccc(-n2c(C=C3C(=O)c4cc5ccccc5cc4C3=O)nc3sc(-c4ccccc4)cc32)cc1 |
| InChI | InChI=1S/C34H26N2O2SSi/c1-40(2,3)25-15-13-24(14-16-25)36-29-20-30(21-9-5-4-6-10-21)39-34(29)35-31(36)19-28-32(37)26-17-22-11-7-8-12-23(22)18-27(26)33(28)38/h4-20H,1-3H3 |
| InChIKey | IYFOAMBFVDLFCG-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|