C22H15N3OS3 — CID 168735450
(5E)-5-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 168735450) has the molecular formula C22H15N3OS3 and a molecular weight of 433.58 g/mol. Its IUPAC name is (5E)-5-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 168735450 |
| Molecular Formula | C22H15N3OS3 |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | (5E)-5-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)/C(=C\c2nc3sc(-c4ccccc4)cc3n2-c2ccccc2)SC1=S |
| InChI | InChI=1S/C22H15N3OS3/c1-24-21(26)18(29-22(24)27)13-19-23-20-16(25(19)15-10-6-3-7-11-15)12-17(28-20)14-8-4-2-5-9-14/h2-13H,1H3/b18-13+ |
| InChIKey | IPPGQRPRWJBURA-QGOAFFKASA-N |
| XLogP | 5.59 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|