C31H15N5OS — CID 168735635
(2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile (PubChem CID 168735635) has the molecular formula C31H15N5OS and a molecular weight of 505.56 g/mol. Its IUPAC name is (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile.
| Compound Name | (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile |
|---|---|
| PubChem CID | 168735635 |
| Molecular Formula | C31H15N5OS |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (2Z)-2-isocyano-2-[(2Z)-2-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-3-oxoinden-1-ylidene]acetonitrile |
| SMILES | [C-]#[N+]/C(C#N)=C1C(=C\c2nc3sc(-c4ccc([N+]#[C-])cc4)cc3n2-c2ccccc2)\C(=O)c2ccccc2\1 |
| InChI | InChI=1S/C31H15N5OS/c1-33-20-14-12-19(13-15-20)27-17-26-31(38-27)35-28(36(26)21-8-4-3-5-9-21)16-24-29(25(18-32)34-2)22-10-6-7-11-23(22)30(24)37/h3-17H/b24-16-,29-25- |
| InChIKey | KVLYPSCUMYAXEQ-DMYLFRKQSA-N |
| XLogP | 7.74 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|