C27H14F2N2O2S — CID 168736136
2-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-4,7-difluoroindene-1,3-dione (PubChem CID 168736136) has the molecular formula C27H14F2N2O2S and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-4,7-difluoroindene-1,3-dione.
| Compound Name | 2-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-4,7-difluoroindene-1,3-dione |
|---|---|
| PubChem CID | 168736136 |
| Molecular Formula | C27H14F2N2O2S |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2-[(1,5-diphenylthieno[2,3-d]imidazol-2-yl)methylidene]-4,7-difluoroindene-1,3-dione |
| SMILES | O=C1C(=Cc2nc3sc(-c4ccccc4)cc3n2-c2ccccc2)C(=O)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C27H14F2N2O2S/c28-18-11-12-19(29)24-23(18)25(32)17(26(24)33)13-22-30-27-20(31(22)16-9-5-2-6-10-16)14-21(34-27)15-7-3-1-4-8-15/h1-14H |
| InChIKey | VRDQURLVYCJZGK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|