C28H19N5O2S — CID 168735544
(5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 168735544) has the molecular formula C28H19N5O2S and a molecular weight of 489.56 g/mol. Its IUPAC name is (5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168735544 |
| Molecular Formula | C28H19N5O2S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | (5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-1-phenylthieno[2,3-d]imidazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2cc3c(nc(/C=C4\C(=O)N(CC)C(=O)C(C#N)=C4C)n3-c3ccccc3)s2)cc1 |
| InChI | InChI=1S/C28H19N5O2S/c1-4-32-27(34)21(17(2)22(16-29)28(32)35)14-25-31-26-23(33(25)20-8-6-5-7-9-20)15-24(36-26)18-10-12-19(30-3)13-11-18/h5-15H,4H2,1-2H3/b21-14- |
| InChIKey | DXUVFNPENPPZHW-STZFKDTASA-N |
| XLogP | 5.92 |
| TPSA | 83.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|