C28H23N5O2 — CID 168735615
(5Z)-1-ethyl-4-methyl-5-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile (PubChem CID 168735615) has the molecular formula C28H23N5O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is (5Z)-1-ethyl-4-methyl-5-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-1-ethyl-4-methyl-5-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168735615 |
| Molecular Formula | C28H23N5O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (5Z)-1-ethyl-4-methyl-5-[(4-methyl-1,5-diphenylpyrrolo[2,3-d]imidazol-2-yl)methylidene]-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCN1C(=O)C(C#N)=C(C)/C(=C/c2nc3c(cc(-c4ccccc4)n3C)n2-c2ccccc2)C1=O |
| InChI | InChI=1S/C28H23N5O2/c1-4-32-27(34)21(18(2)22(17-29)28(32)35)15-25-30-26-24(33(25)20-13-9-6-10-14-20)16-23(31(26)3)19-11-7-5-8-12-19/h5-16H,4H2,1-3H3/b21-15- |
| InChIKey | RPPGRGIQAZOFIO-QNGOZBTKSA-N |
| XLogP | 4.64 |
| TPSA | 83.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|