C21H13N5O3S — CID 168735490
(5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 168735490) has the molecular formula C21H13N5O3S and a molecular weight of 415.43 g/mol. Its IUPAC name is (5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 168735490 |
| Molecular Formula | C21H13N5O3S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (5Z)-1-ethyl-5-[[5-(4-isocyanophenyl)-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2nc3oc(/C=C4\C(=O)N(CC)C(=O)C(C#N)=C4C)nc3s2)cc1 |
| InChI | InChI=1S/C21H13N5O3S/c1-4-26-20(27)14(11(2)15(10-22)21(26)28)9-16-24-19-17(29-16)25-18(30-19)12-5-7-13(23-3)8-6-12/h5-9H,4H2,1-2H3/b14-9- |
| InChIKey | PNJUFOASKHWVHF-ZROIWOOFSA-N |
| XLogP | 4.11 |
| TPSA | 104.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|